Synonym: 6α-Methylprednisolone sodium succinate; MPSL; 6α-Methyl-11β,17α,21-trihydroxy-1,4-pregnadiene-3,20-dione 21-hemisuccinate
CAS Number: 2375-03-3
Empirical Formula (Hill Notation): C26H33NaO8
Molecular Weight: 496.53
EC Number: 219-156-8
MDL Number: MFCD00152612
Linear Formula: C26H33O8Na
Product Type: Chemical
| assay |
≥98.00% (TLC) |
| biological source |
synthetic |
| form |
lyophilized powder |
| InChI |
1S/C26H34O8.Na/c1-14-10-16-17-7-9-26(33,20(29)13-34-22(32)5-4-21(30)31)25(17,3)12-19(28)23(16)24(2)8-6-15(27)11-18(14)24;/h6,8,11,14,16-17,19,23,28,33H,4-5,7,9-10,12-13H2,1-3H3,(H,30,31);/q;+1/p-1/t14-,16-,17-,19-,23+,24-,25-,26-;/m0./s1 |
| InChI key |
FQISKWAFAHGMGT-SGJOWKDISA-M |
| Quality Level |
100  |
| shipped in |
ambient |
| SMILES string |
[Na+].C[C@H]1CC2C3CC[C@](O)(C(=O)COC(=O)CCC([O-])=O)[C@@]3(C)C[C@H](O)C2[C@@]4(C)C=CC(=O)C=C14 |
| solubility |
water: 50 mg/mL, clear, colorless to faintly yellow |
| sterility |
non-sterile |
| storage temp. |
room temp |
| technique(s) |
toxicology assay: suitable |
| Application: |
6α-methylprednisolone 21-hemisuccinate sodium salt has been used to investigate glucocorticoid-induced osteonecrosis under hypoxic conditions in the MC3T3-E1 osteoblast cell line using a cell cytotoxicity assay, flow cytometry and western blotting. |
| Biochem/physiol Actions: |
Glucocorticoid with slightly longer half-life than that of prednisolone. |
| Physical form: |
Lyophilized containing ~5% phosphate buffer salts. |
| Symbol |
 GHS08 |
| Signal word |
Danger |
| Hazard statements |
H351 - H360 |
| Precautionary statements |
P201 - P308 + P313 |
| Hazard Codes |
T |
| Risk Statements |
61-40 |
| Safety Statements |
53-22-36/37/39-45 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98.00% (TLC) |
| Storage Temp. |
room temp |
| UNSPSC |
51111800 |
