N-Methoxysuccinyl-Ala-Ala-Pro-Val-7-amido-4-methylcoumarin
SIGMA/M9771 - elastase substrate
Synonym: MeOSuc-AAPV-AMC
CAS Number: 72252-90-5
Empirical Formula (Hill Notation): C31H41N5O9
Molecular Weight: 627.69
MDL Number: MFCD00077135
Linear Formula: C31H41N5O9
Product Type: Chemical
| assay | ≥98% (HPLC) |
| form | powder |
| InChI | 1S/C31H41N5O9/c1-16(2)27( |
| InChI key | CMEUDEVBFFPSEI-UHFFFAOYSA |
| Quality Level | 200 ![]() |
| SMILES string | COC(=O)CCC(=O)NC(C)C(=O)N |
| solubility | chloroform: 50 mg/mL, clear, colorless |
| storage temp. | −20°C |
| Application: | N-Methoxysuccinyl-Ala-Ala- |
| General description: | Fluorogenic substrate for the assay of human leukocyte and porcine pancreatic elastase. |
| Packaging: | Bottomless glass bottle. Contents are inside inserted fused cone. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98% (HPLC) |
| Storage Temp. | −20°C |
| UNSPSC | 12352204 |

