Mayer′s Hematoxylin Solution
SIGMA/MHS32
Synonym: (6aS,11bR)
MDL Number: MFCD00078111
Product Type: Chemical
| application(s) | hematology histology |
| concentration | 1 g/L |
| form | solution |
| InChI | 1S/C16H14O6/c17-10-2-1-8- |
| InChI key | WZUVPPKBWHMQCE-XJKSGUPXSA |
| IVD | for in vitro diagnostic use |
| pH | 2.4 (25 °C) |
| Quality Level | 500 ![]() |
| shelf life | Expiry date on the label. |
| SMILES string | Oc1cc2C[C@@]3(O)COc4c(O)c |
| storage temp. | room temp |
| technique(s) | microbe id | staining: suitable |
| Application: | General purpose nuclear stain, progressive type. Used with hematoxylin and eosin staining. |
| General description: | Used as a counterstain for procedures such as immunohistochemistry or laser microdissection. |
| Other Notes: | 1 g/L certified hematoxylin |
| Symbol | GHS06 |
| Signal word | Danger |
| Hazard statements | H331 |
| Precautionary statements | P261 - P271 - P304 + P340 + P311 - P403 + P233 - P405 - P501 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Storage Temp. | room temp |
| UNSPSC | 41116124 |


