Nervonic acid
SIGMA/N1514 - ≥99% (capillary GC)
Synonym: cis-15-Tetracosenoic acid; Selacholeic acid
CAS Number: 506-37-6
Empirical Formula (Hill Notation): C24H46O2
Molecular Weight: 366.62
MDL Number: MFCD00010507
Linear Formula: CH3(CH2)7CH=CH(CH2)13COOH (cis)
Product Type: Chemical
| assay | ≥99% (capillary GC) |
| biological source | plant |
| form | powder |
| functional group | carboxylic acid |
| InChI | 1S/C24H46O2/c1-2-3-4-5-6- |
| InChI key | GWHCXVQVJPWHRF-KTKRTIGZSA |
| lipid type | unsaturated FAs |
| mp | 42-43 °C (lit.) |
| Quality Level | 100 ![]() |
| shipped in | ambient |
| SMILES string | CCCCCCCCC=C/CCCCCCCCCCCC |
| storage temp. | −20°C |
| Application: | Nervonic acid has been used as a synthetic lipid supplement in vitro to study about effect of the developmental diet in Drosophila lifespan. |
| Biochem/physiol Actions: | Nervonic acid (C24:1), a component of membrane sphingolipids and phosphatidylethanolamines |
| Packaging: | 100 mg in ampule |
| Packaging: | Sealed ampule. |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Purity | ≥99% (capillary GC) |
| mp | 42-43 °C (lit.) |
| Storage Temp. | −20°C |
| UNSPSC | 12352211 |


