Synonym: 2β,3β,14α,20R,22R-Pentahydroxy-5β-cholest-7-en-6-one; 25-Deoxy-20-hydroxyecdysone; 25-Deoxyecdysterone
CAS Number: 13408-56-5
Empirical Formula (Hill Notation): C27H44O6
Molecular Weight: 464.63
MDL Number: MFCD00272144
Linear Formula: C27H44O6
Product Type: Chemical
| biological source |
synthetic (organic) |
| concentration |
≥65% |
| form |
powder |
| InChI |
1S/C27H44O6/c1-15(2)6-7-23(31)26(5,32)22-9-11-27(33)17-12-19(28)18-13-20(29)21(30)14-24(18,3)16(17)8-10-25(22,27)4/h12,15-16,18,20-23,29-33H,6-11,13-14H2,1-5H3/t16-,18-,20+,21-,22-,23+,24+,25+,26+,27+/m0/s1 |
| InChI key |
PJYYBCXMCWDUAZ-JJJZTNILSA-N |
| Quality Level |
200  |
| shipped in |
ambient |
| SMILES string |
CC(C)CC[C@@H](O)[C@](C)(O)[C@H]1CC[C@@]2(O)C3=CC(=O)[C@@H]4C[C@@H](O)[C@@H](O)C[C@]4(C)[C@H]3CC[C@]12C |
| solubility |
ethanol: soluble |
| sterility |
non-sterile |
| storage temp. |
−20°C |
| Application: |
Ponasterone A has been used to induce the expression of human huntingtin (HTT). |
| Application: |
Suitable as an inducer of ecdysone-inducible mammalian expression system. |
| Biochem/physiol Actions: |
Ponasterone A is an analogue of ecdysone. |
| Biochem/physiol Actions: |
Ponasterone A is an insect hormone, involved in regulating metamorphosis. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Storage Temp. |
−20°C |
| UNSPSC |
51111800 |
