TWEEN® 80
SIGMA/P5188 - Molecular Biology, syrup
Synonym: POE (20) sorbitan monooleate; Polyethylene glycol sorbitan monooleate; Polyoxyethylenesorbitan monooleate; Polysorbate 80
CAS Number: 9005-65-6
MDL Number: MFCD00082107
Product Type: Chemical
| CMC | 0.012 mM |
| composition | Oleic acid, ≥58.0% (balance primarily linoleic, palmitic, and stearic acids) |
| density | 1.06 g/mL at 25 °C |
| description | non-ionic |
| foreign activity | DNAse (Exonuclease Detection), NICKase (Endonuclease Detection), RNAse, none detected |
| form | syrup |
| grade | Molecular Biology |
| HLB | 15 |
| InChI | 1S/C32H60O10/c1-2-3-4-5-6 |
| InChI key | RGPBUVUVZKQNHD-MDZDMXLPSA |
| mol wt | average mol wt 1310 |
| Quality Level | 200  |
| SMILES string | CCCCCCCC/C=C/CCCCCCCC(=O) |
| suitability | molecular biology tested |
| transition temp | cloud point 65 °C |
| Application: | Non-ionic detergent used for selective protein extraction and isolation of nuclei from mammalian cell lines. |
| General description: | TWEEN 80 is a polyethylene sorbitol ester and has a molecular weight of 1.31 kDa. It is useful as a stabilizer and emulsifier commercially. It is known to be used in ice-cream for its drying property. |
| Legal Information: | TWEEN is a registered trademark of Croda International PLC |
| Packaging: | 100 mL in poly bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Density | 1.06 g/mL at 25 °C |
| UNSPSC | 12161900 |