Pyrrolnitrin from Pseudomonas cepacia
SIGMA/P8861 - ≥98% (HPLC), solid
Synonym: 3-
CAS Number: 1018-71-9
EC Number: 213-812-7
MDL Number: MFCD00865605
Product Type: Chemical
| antibiotic activity spectrum | fungi |
| assay | ≥98% (HPLC) |
| form | solid |
| InChI | 1S/C10H6Cl2N2O2/c11-8-3-1 |
| InChI key | QJBZDBLBQWFTPZ-UHFFFAOYSA |
| mode of action | enzyme | inhibits |
| Quality Level | 200  |
| shipped in | wet ice |
| SMILES string | [O-][N+](=O)c1c(Cl)cccc1- |
| storage temp. | −20°C |
| Application: | Pyrrolnitrin from Pseudomonas cepacia has been used as a standard in the detection of pyrrolnitrin in Serratia marcescens cell culture extract. |
| Biochem/physiol Actions: | Pyrrolnitrin blocks the terminal electron transport between succinate or reduced NADH and coenzyme Q. In mitochondria preparations of S. cerevisiae, the antibiotic inhibited succinate oxidase, NADH oxidase, succinate cythochrome C reductase, and NADH-cytochrome C reductase. Pyrrolnitrin is involved in many cellular processes such as oxidative stress, electron transport, DNA and RNA synthesis. |
| Biochem/physiol Actions: | Pyrrolnitrin is a metabolite, produced by Pseudomonas sp. |
| Biochem/physiol Actions: | The purified antibiotic has strong antifungal activity and is less efficient against bacteria or yeast. |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98% (HPLC) |
| Storage Temp. | −20°C |
| UNSPSC | 12352200 |