PD 169316
SIGMA/P9248 - ≥98% (HPLC), solid
Synonym: 4-
CAS Number: 152121-53-4
Empirical Formula (Hill Notation): C20H13FN4O2
Molecular Weight: 360.34
MDL Number: MFCD12405019
Linear Formula: C20H13FN4O2
Product Type: Chemical
| assay | ≥98% (HPLC) |
| color | faint yellow to dark orange |
| form | solid |
| InChI | 1S/C20H13FN4O2/c21-16-5-1 |
| InChI key | BGIYKDUASORTBB-UHFFFAOYSA |
| originator | GlaxoSmithKline |
| Quality Level | 100  |
| SMILES string | [O-][N+](=O)c1ccc(cc1)-c2 |
| solubility | DMSO: >10 mg/mL |
| H2O: insoluble | |
| storage temp. | 2-8°C |
| Application: | PD 169316 has been used for the inhibition of p38 enzyme in human hepatocytes. It has been used in culture media to promote embryoid bodies differentiation. |
| Biochem/physiol Actions: | Potent, cell-permeable and selective p38 MAP kinase inhibitor (IC50 = 89 nM). |
| Features and Benefits: | This compound was developed by GlaxoSmithKline . To browse the list of other pharma-developed compounds and Approved Drugs/Drug Candidates, click here . |
| General description: | PD 169316 is a pyridinyl imidazole compound. It is a potential inhibitor of p38 mitogen-activated protein kinases. It also inhibits signalling transforming growth factor β (TGFβ), particularly in human ovarian cancer cells. |
| Packaging: | 5, 25 mg in glass bottle |
| Symbol |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301 - H315 - H318 - H335 |
| Precautionary statements | P280 - P301 + P310 + P330 - P302 + P352 - P305 + P351 + P338 + P310 |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98% (HPLC) |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352200 |