Methyl palmitoleate
SIGMA/P9667 - ≥99% (capillary GC), liquid
Synonym: Methyl cis-9-hexadecenoate; Palmitoleic acid methyl ester
CAS Number: 1120-25-8
Empirical Formula (Hill Notation): C17H32O2
Molecular Weight: 268.43
EC Number: 214-303-2
MDL Number: MFCD00042911
Linear Formula: CH3(CH2)5CH=CH(CH2)7COOCH3
Product Type: Chemical
Representative of vacuum-sealed clear ampule packaging. Non-uniform tips are an inherent feature in this sealing process.
| assay | ≥99% (capillary GC) |
| biological source | Macadamia integrifolia oil |
| bp | 180-183 °C/1 mmHg (lit.) |
| density | 0.875 g/mL at 25 °C (lit.) |
| form | liquid |
| functional group | ester |
| InChI | 1S/C17H32O2/c1-3-4-5-6-7- |
| InChI key | IZFGRAGOVZCUFB-HJWRWDBZSA |
| lipid type | unsaturated FAs |
| mp | −0.5-0.5 °C (lit.) |
| Quality Level | 200  |
| refractive index | n |
| shipped in | ambient |
| SMILES string | CCCCCCC=C/CCCCCCCC(=O)OC |
| storage temp. | −20°C |
| Application: |
|
| Packaging: | 1 g in ampule |
| Packaging: | 100, 500 mg in ampule |
| Packaging: | Sealed ampule. |
).| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | 235.4 °F - closed cup |
| Flash Point(C) | 113.0 °C - closed cup |
| Purity | ≥99% (capillary GC) |
| bp | 180-183 °C/1 mmHg (lit.) |
| mp | −0.5-0.5 °C (lit.) |
| Density | 0.875 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| Storage Temp. | −20°C |
| UNSPSC | 12352211 |