Synonym: (βR)-3-(Aminocarbonyl)-β-(3-cyclohexylpropyl)-N-hydroxy-1,2,4-oxadiazole-5-propanamide; 5-{(1R)-4-Cyclohexyl-1-[2-(hydroxyamino)-2-oxoethyl]butyl}-1,2,4-oxadiazole-3-carboxamide
CAS Number: 348622-88-8
Empirical Formula (Hill Notation): C15H24N4O4
Molecular Weight: 324.38
MDL Number: MFCD19690945
Linear Formula: C15H24N4O4
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to off-white |
| form |
powder |
| InChI |
1S/C15H24N4O4/c16-13(21)14-17-15(23-19-14)11(9-12(20)18-22)8-4-7-10-5-2-1-3-6-10/h10-11,22H,1-9H2,(H2,16,21)(H,18,20)/t11-/m1/s1 |
| InChI key |
ARJCBSRIPGJMAD-LLVKDONJSA-N |
| optical activity |
[α]/D 14.0 to 23.0°, c = 0.5 in methanol |
| Quality Level |
100  |
| SMILES string |
NC(=O)c1noc(n1)[C@H](CCCC2CCCCC2)CC(=O)NO |
| solubility |
DMSO: >30 mg/mL |
| storage temp. |
room temp |
| Biochem/physiol Actions: |
Procollagen C-proteinase (PCP) inhibitor. |
| Biochem/physiol Actions: |
UK-383,367 is a procollagen C-proteinase (PCP) inhibitor. |
| Packaging: |
5, 25 mg in glass bottle |
| Symbol |
 GHS06 |
| Signal word |
Danger |
| Hazard statements |
H301 |
| Precautionary statements |
P301 + P310 |
| Hazard Codes |
Xn |
| Risk Statements |
22 |
| RIDADR |
UN 2811 6.1 / PGIII |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
room temp |
| UNSPSC |
41121800 |
