Synonym: β-(3,5-Dioxo-1,2,4-oxadiazolidin-2-yl)-L-alanine; 3-(3,5-Dioxo-1,2,4-oxadiazolidin-2-yl)-L-alanine
CAS Number: 52809-07-1
Empirical Formula (Hill Notation): C5H7N3O5
Molecular Weight: 189.13
MDL Number: MFCD00069337
Linear Formula: C5H7N3O5
Product Type: Chemical
| color |
white to off-white |
| form |
powder |
| InChI |
1S/C5H7N3O5/c6-2(3(9)10)1-8-4(11)7-5(12)13-8/h2H,1,6H2,(H,9,10)(H,7,11,12)/t2-/m0/s1 |
| InChI key |
ASNFTDCKZKHJSW-REOHCLBHSA-N |
| Quality Level |
200  |
| SMILES string |
N[C@@H](CN1OC(=O)NC1=O)C(O)=O |
| solubility |
0.1 M HCl: 1.4 mg/mL |
| |
1 M NH4OH: 20 mg/mL |
| |
ethanol: <0.17 mg/mL |
| |
H2O: 0.5 mg/mL |
| |
organic solvents: insoluble |
| storage temp. |
2-8°C |
| Application: |
Quisqualic acid has also been used as a group I metabotropic receptor agonist in neurons. |
| Application: |
Quisqualic acid has been used to test ligand-gated receptors in spiral ganglion neurons. |
| Biochem/physiol Actions: |
Active enantiomer of quisqualic acid; excitatory amino acid at glutamate receptors. |
| General description: |
Quisqualate/ Quisqualic acid is obtained from the fruits and seeds of Quisqualis chinensis. It is an agonist at two subsets of excitatory amino acid receptors metabotropic receptors that indirectly mediate calcium mobilization from intracellular stores and, ionotropic receptors that directly control membrane channels. L-quisqualic acid is an agonist of the neurotransmitter L-glutamate. |
| Packaging: |
1, 5 mg in glass bottle |
| Packaging: |
10, 25 mg in poly bottle |
| Hazard Codes |
Xn |
| Risk Statements |
20/21/22 |
| Safety Statements |
26-36 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352106 |
