RN-1747
SIGMA/R1033 - ≥98% (HPLC)
Synonym: 1-
CAS Number: 1024448-59-6
Empirical Formula (Hill Notation): C17H18ClN3O4S
Molecular Weight: 395.86
MDL Number: MFCD04154169
Linear Formula: C17H18ClN3O4S
Product Type: Chemical
| assay | ≥98% (HPLC) |
| color | light yellow to light tan |
| form | powder |
| InChI | 1S/C17H18ClN3O4S/c18-15-6 |
| InChI key | ZNLVYSJQUMALEO-UHFFFAOYSA |
| Quality Level | 100  |
| SMILES string | [O-][N+](=O)c1cc(Cl)ccc1S |
| solubility | DMSO: ≥10 mg/mL |
| storage temp. | 2-8°C |
| Biochem/physiol Actions: | TRPV4, a close relative of the vanilloid receptor TRPV1, is activated by diverse modalities such as endogenous lipid ligands, hypotonicity, protein kinases and, possibly, mechanical inputs. |
| Biochem/physiol Actions: | TRPV4, a close relative of the vanilloid receptor TRPV1, is activated by diverse modalities such as endogenous lipid ligands, hypotonicity, protein kinases and, possibly, mechanical inputs. TRPV4 is a nociceptor playing an important role in inflammatory and neuropathic mechanical hyperalgesia in rodent models apparently specifically activated under pathological conditions. |
| Packaging: | 5, 25 mg in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98% (HPLC) |
| Storage Temp. | 2-8°C |
| UNSPSC | 51111800 |