Synonym: (2E)-3-Phenyl-N-[2,2,2-trichloro-1-[[[(4-chlorophenyl)amino]thioxomethyl]amino]ethyl]-2-propenamide; 3-Phenyl-N-(2,2,2-trichloro-1-((((4-chlorophenyl)amino)carbonothioyl)amino)ethyl)acrylamide
CAS Number: 1164470-53-4
Empirical Formula (Hill Notation): C18H15Cl4N3OS
Molecular Weight: 463.21
MDL Number: MFCD00361095
Linear Formula: C18H15Cl4N3OS
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to off-white |
| compatibility |
for use with Bio-Rad CFX96 |
| form |
powder |
| InChI |
1S/C18H15Cl4N3OS/c19-13-7-9-14(10-8-13)23-17(27)25-16(18(20,21)22)24-15(26)11-6-12-4-2-1-3-5-12/h1-11,16H,(H,24,26)(H2,23,25,27)/b11-6+ |
| InChI key |
TVNBASWNLOIQML-IZZDOVSWSA-N |
| Quality Level |
100  |
| SMILES string |
Clc1ccc(NC(=S)NC(NC(=O)C=Cc2ccccc2)C(Cl)(Cl)Cl)cc1 |
| solubility |
DMSO: ≥10 mg/mL |
| storage condition |
desiccated |
| |
protect from light |
| storage temp. |
2-8°C |
| Application: |
Sal003 was used to study the role of eIF2α in Subtilase cytotoxin-induced apoptosis in HeLa cells. |
| Biochem/physiol Actions: |
Sal003 inhibits the late long-term potentiation (L-LTP) and long-term memory formation in mammalian hippocampal slices. The effect of Sal003 on L-LTP is mediated by the transcription factor, ATF4. |
| Biochem/physiol Actions: |
Sal003 is a potent and cell-permeable eIF-2a phosphatase inhibitor. |
| Packaging: |
5, 25 mg in glass bottle |
| Symbol |
 GHS09 |
| Signal word |
Warning |
| Hazard statements |
H410 |
| Precautionary statements |
P273 - P501 |
| Hazard Codes |
N |
| Risk Statements |
50/53 |
| Safety Statements |
60-61 |
| RIDADR |
UN 3077 9 / PGIII |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
