5-Sulfosalicylic acid dihydrate
SIGMA/S7422 - BioXtra, ≥99.0%
Synonym: 2-
CAS Number: 5965-83-3
Empirical Formula (Hill Notation): C7H6O6S · 2H2O
Molecular Weight: 254.21
EC Number: 202-555-6
MDL Number: MFCD00149540
Linear Formula: HO3SC6H3-2-(OH)CO2H·2H2O
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material.
This image depicts SKU: S7422-100G
This image depicts SKU: S7422-100G
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material.
This image depicts SKU: S7422-500G
This image depicts SKU: S7422-500G
| anion traces | chloride (Cl-): ≤0.001% |
| sulfate (SO42-): ≤0.1% | |
| assay | ≥99.0% |
| cation traces | Al: ≤0.002% |
| Ca: ≤0.005% | |
| Cu: ≤0.0005% | |
| Fe: ≤0.002% | |
| K: ≤0.005% | |
| Mg: ≤0.0005% | |
| Na: ≤0.005% | |
| NH4+: ≤0.05% | |
| Pb: ≤0.001% | |
| Zn: ≤0.0005% | |
| functional group | carboxylic acid |
| sulfonic acid | |
| grade | BioPerformance Certified |
| ign. residue | ≤0.1% |
| impurities | ≤0.0005% Phosphorus (P) |
| ≤0.02% Insoluble matter | |
| InChI | 1S/C7H6O6S.2H2O/c8-6-2-1- |
| InChI key | BHDKTFQBRFWJKR-UHFFFAOYSA |
| mp | 105-110 °C (lit.) |
| product line | BioXtra |
| Quality Level | 200  |
| SMILES string | [H]O[H].[H]O[H].OC(=O)c1c |
| solubility | H2O: 1 M, clear, colorless |
| General description: | 5-Sulfosalicylic acid dihydrate is a poly functional metal chelating agent. Within industry, it is used in the manufacture of organic catalysts and grease additives. Additionally, it serves as a colorimetric reagent for the detection of ferric ions, producing a violet color. This characteristic is particularly valuable for quantifying the amount of albumin in urine. |
| Packaging: | 100, 500 g in poly bottle |
| Symbol |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260 - P280 - P301 + P330 + P331 - P303 + P361 + P353 - P304 + P340 + P310 - P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8 / PGII |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.0% |
| mp | 105-110 °C (lit.) |
| UNSPSC | 12352100 |