Synonym: (5Z,11α,13E,15R)--11,15-Dihydroxy-9-oxo-16-phenoxy-17,18,19,20-tetranorprosta-5,13-dienoic acid methane sulfonamide; CP-34089; SHB-286; ZK-57671
CAS Number: 60325-46-4
Empirical Formula (Hill Notation): C23H31NO7S
Molecular Weight: 465.56
EC Number: 262-173-0
MDL Number: MFCD00216056
Linear Formula: C23H31NO7S
Product Type: Chemical
| assay |
≥95% (HPLC) |
| color |
colorless to yellow-brown |
| form |
oil |
| InChI |
1S/C23H31NO7S/c1-32(29,30)24-23(28)12-8-3-2-7-11-19-20(22(27)15-21(19)26)14-13-17(25)16-31-18-9-5-4-6-10-18/h2,4-7,9-10,13-14,17,19-20,22,25,27H,3,8,11-12,15-16H2,1H3,(H,24,28)/b7-2-,14-13+/t17-,19-,20-,22-/m1/s1 |
| InChI key |
UQZVCDCIMBLVNR-TWYODKAFSA-N |
| Quality Level |
100  |
| shipped in |
wet ice |
| SMILES string |
CS(=O)(=O)NC(=O)CCCC=C/C[C@@H]1[C@@H](C=C[C@@H](O)COc2ccccc2)[C@H](O)CC1=O |
| solubility |
DMSO: >10 mg/mL |
| storage temp. |
−20°C |
| Application: |
Human chondrocytes3 and mouse adrenal chromaffin cells4 were treated with sulprostone to study the biological effects of PGE2. |
| Biochem/physiol Actions: |
Selective EP3 prostanoid receptor agonist. |
| Biochem/physiol Actions: |
Sulprostone is an analog of prostaglandin E2 (PGE2)1 and antagonizes vasopressin-induced antidiuretic responses in cells from rat renal inner medullae by a mechanism that involves activation of Rho.2 |
| Packaging: |
1, 5 mg in glass bottle |
| Purity |
≥95% (HPLC) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352200 |
GHS07,GHS08