Synonym: 4-[2-(5,6,7,8-Tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)-1,3-dioxolan-2-yl]-benzoic acid; BMS 188649; BMS649
CAS Number: 146670-40-8
Empirical Formula (Hill Notation): C24H28O4
Molecular Weight: 380.48
MDL Number: MFCD00864137
Linear Formula: C24H28O4
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to off-white |
| form |
powder |
| InChI |
1S/C24H28O4/c1-22(2)11-12-23(3,4)20-15-18(9-10-19(20)22)24(27-13-14-28-24)17-7-5-16(6-8-17)21(25)26/h5-10,15H,11-14H2,1-4H3,(H,25,26) |
| InChI key |
ZZUKALQMHNSWTK-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
CC1(C)CCC(C)(C)c2cc(ccc12)C3(OCCO3)c4ccc(cc4)C(O)=O |
| solubility |
DMSO: >28 mg/mL (warmed) |
| storage temp. |
2-8°C |
| Application: |
SR11237 may be used in RXR-mediated cell signaling studies. |
| Biochem/physiol Actions: |
SR11237 and other ligands of retinoid X receptor (RXR) activate various nuclear receptors during development process. This produces malformations in Xenopus embryos, involving the anterior-posterior axis.1 |
| Biochem/physiol Actions: |
SR11237 is a pan retinoid X receptor (RXR) agonist. |
| Biochem/physiol Actions: |
SR11237 is a selective pan retinoid X receptor (RXR) agonist with no retinoid A receptor (RAR) activity. |
| Packaging: |
5, 25 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
