Synonym: 1,2,3,4-Tetrahydro-2-[[5-(methylthio)-2-thienyl]carbonyl]-3-isoquinolinecarboxylic acid ethyl ester
CAS Number: 1254944-66-5
Empirical Formula (Hill Notation): C18H19NO3S2
Molecular Weight: 361.48
MDL Number: MFCD18782736
Linear Formula: C18H19NO3S2
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white |
| form |
lyophilized powder |
| InChI |
1S/C18H19NO3S2/c1-3-22-18(21)14-10-12-6-4-5-7-13(12)11-19(14)17(20)15-8-9-16(23-2)24-15/h4-9,14H,3,10-11H2,1-2H3 |
| InChI key |
UIEBLUZPSFAFOC-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
CCOC(=O)C1Cc2ccccc2CN1C(=O)c3ccc(SC)s3 |
| solubility |
DMSO: ≥30 mg/mL |
| storage temp. |
2-8°C |
| Application: |
SR8278 has been used as a nuclear receptor subfamily 1, group D, member 1 (NR1D1) antagonist to study its effects on starvation-induced macrophages. |
| Application: |
SR8278 was used as rev-erb alpha antagonist to study the regulation of glucagon secretion in mouse pancreatic alpha cells1 and beta cells.2 |
| Biochem/physiol Actions: |
SR8278 is a Nuclear Heme Receptor REV-ERB antagonist. |
| Biochem/physiol Actions: |
SR8278 is a Nuclear Heme Receptor REV-ERB antagonist. REV-ERBα plays a critical role in regulation of the circadian rhythm by repressing target gene activities. Additionally, REV-ERBα has been shown to regulate metabolic processes including lipid and glucose metabolism. SR8278 blocks the ability of the synthetic agonist GSK4112 to enhance REV-ERBα-dependent repression and stimulates the expression of REV-ERBα target genes involved in gluconeogenesis. |
| Packaging: |
5, 25 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |