Synonym: (2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid 4,4-dioxide; Betamaze; CP 45899; CP-45,899; Penicillanic acid 1,1-dioxide; Penicillanic acid S,S-dioxide; Penicillanic acid dioxide; Penicillanic acid sulfone
CAS Number: 68373-14-8
Empirical Formula (Hill Notation): C8H11NO5S
Molecular Weight: 233.24
EC Number: 269-878-2
MDL Number: MFCD00867005
Linear Formula: C8H11NO5S
Product Type: Chemical
| assay |
98-102% (HPLC) |
| color |
white to off-white |
| form |
crystalline powder |
| InChI |
1S/C8H11NO5S/c1-8(2)6(7(11)12)9-4(10)3-5(9)15(8,13)14/h5-6H,3H2,1-2H3,(H,11,12)/t5-,6+/m1/s1 |
| InChI key |
FKENQMMABCRJMK-RITPCOANSA-N |
| Quality Level |
100  |
| SMILES string |
CC1(C)[C@@H](N2[C@@H](CC2=O)S1(=O)=O)C(O)=O |
| solubility |
H2O: 1% |
| storage temp. |
2-8°C |
| Application: |
Sulbactam has been used as a β-Lactamase inhibitor in β-lactamase inhibitor assay. It has also been used to evaluate its antimicrobial pharmacodynamic effects against extremely drug-resistant Acinetobacter baumannii. Sulbactam may be used in cell signaling studies. |
| Biochem/physiol Actions: |
Sulbactam acts as an irreversible inhibitor of β-lactamases that inactivate β-lactams such as penicillin and cephalosporin. It is also active against bacteroides and certain chromosomally mediated enzymes of Gram-negative bacteria. It exhibits limited antimicrobial activity. However, sulbactam in combination with other potential antibiotics exhibits therapeutic effects against multidrug-resistant Acinetobacter baumannii infections. |
| General description: |
Sulbactam is a semi-synthetic penicillinate sulfone derived from 6-aminopenicllanic acid. This β-lactam compound is characterized by a β-lactam ring. |
| Packaging: |
10, 50 mg in glass bottle |
| Symbol |
 GHS07 |
| Signal word |
Warning |
| Hazard statements |
H302 |
| Hazard Codes |
Xn |
| Risk Statements |
22 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
98-102% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
