Synonym: (3S,11E)-3,4,5,6,9,10-hexahydro-14,16-dihydroxy-3-methyl-,1H-2-benzoxacyclotetradecin-1,7(8H)-dione; F-2 toxin
CAS Number: 17924-92-4
Empirical Formula (Hill Notation): C18H22O5
Molecular Weight: 318.36
MDL Number: MFCD00133085
Linear Formula: C18H22O5
Product Type: Chemical
| concentration |
1 mg/mL in DMSO |
| form |
liquid |
| InChI |
1S/C18H22O5/c1-12-6-5-9-14(19)8-4-2-3-7-13-10-15(20)11-16(21)17(13)18(22)23-12/h3,7,10-12,20-21H,2,4-6,8-9H2,1H3/b7-3+/t12-/m0/s1 |
| InChI key |
MBMQEIFVQACCCH-QBODLPLBSA-N |
| SMILES string |
O1[C@H](CCCC(=O)CCCC=Cc2c(c(cc(c2)O)O)C1=O)C |
| storage temp. |
−20°C |
| Biochem/physiol Actions: |
Zearalenone, a fungal mycotoxin produced by Fusarium graminearum, binds estrogen receptor (ER) causing conformational alteration to the receptor. Zearalenone is a common contaminant in cereal grain used for animal and human food. It exerts an estrogenic activity that modulates/disrupts endocrine function in animals and possibly humans. Furthermore, zearalenone was found to act as an immune-toxic compound, which can cause food consumption reduction in rats. |
| WGK Germany |
WGK 2 |
| Flash Point(F) |
188.6 °F - closed cup |
| Flash Point(C) |
87 °C - closed cup |
| Storage Temp. |
−20°C |
| UNSPSC |
85151701 |
