Synonym: Stearidonic acid; (6Z,9Z,12Z,15Z)-Octadecatetraenoic acid; Moroctic acid; Stearidonate; 6Z,9Z,12Z,15Z-Octadecatetraenoic acid; Moroctic acid; all-cis-6,9,12,15-Octadecatetraenoic acid
CAS Number: 20290-75-9
Empirical Formula (Hill Notation): C18H28O2
Molecular Weight: 276.41
MDL Number: MFCD00216036
Linear Formula: C18H28O2
Product Type: Chemical
| assay |
≥99% |
| form |
liquid |
| functional group |
carboxylic acid |
| InChI |
1S/C18H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10,12-13H,2,5,8,11,14-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-,13-12- |
| InChI key |
JIWBIWFOSCKQMA-LTKCOYKYSA-N |
| lipid type |
omega FAs |
| Quality Level |
200  |
| shipped in |
ambient |
| SMILES string |
CCC=C/CC=C/CC=C/CC=C/CCCCC(O)=O |
| storage temp. |
−20°C |
| Biochem/physiol Actions: |
An 18-carbon, ω-3 fatty acid which is a dietary precursor to eicosapentaenoic acid (EPA) and docosahexaenoic acid (DHA). Stearidonic acid is present in small amounts in seed oils. |
| Biochem/physiol Actions: |
Stearidonic acid is an 18-carbon containing polyunsaturated fatty acid (PUFA). It belongs to the class of ω-3 fatty acids, which are dietary precursors to eicosapentaenoic acid (EPA) and docosahexaenoic acid (DHA). Stearidonic acid is present in small amounts in seed oils. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥99% |
| Storage Temp. |
−20°C |
| UNSPSC |
12352211 |
