Synonym: N-Acetylglucosaminyl-β-1,2-mannose; β-1-2 N-acetylglucosamine mannose; 2-O-(2-acetamido-2-deoxy-β-D-glucopyranosyl)-D-mannopyranose; GlcNAc-β-1,2-Man; N-Acetyl-glucosamine mannose; β-D-GlcNAc-(1→2)-D-Man
CAS Number: 34621-73-3
Empirical Formula (Hill Notation): C14H25NO11
Molecular Weight: 383.35
Linear Formula: C14H25NO11
Product Type: Chemical
| assay |
≥94% (HPLC) |
| form |
powder |
| InChI |
1S/C14H25NO11/c1-5(19)15-9-13(24)12(23)8(4-18)26-14(9)25-7(3-17)11(22)10(21)6(20)2-16/h3,6-14,16,18,20-24H,2,4H2,1H3,(H,15,19)/t6-,7-,8-,9-,10-,11-,12-,13-,14-/m1/s1 |
| InChI key |
WCIQTQUMKQRLKV-ZTGOBPNGSA-N |
| Quality Level |
200  |
| shipped in |
wet ice |
| SMILES string |
CC(N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O[C@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO)=O |
| storage temp. |
−20°C |
| Biochem/physiol Actions: |
N-Acetyglucosaminyl-beta-1,2-mannose is a common oligosaccharide that inhibits the adherence of typical and atypical respiratory pathogens. |
| Packaging: |
1 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥94% (HPLC) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352201 |
