Synonym: Geniposidic acid; (1S,4aS,7aS)-1-(β-D-Glucopyranosyloxy)-1,4a,5,7a-tetrahydro-7-(hydroxymethyl)-cyclopenta[c]pyran-4-carboxylic acid
CAS Number: 27741-01-1
Empirical Formula (Hill Notation): C16H22O10
Molecular Weight: 374.34
MDL Number: MFCD00210294
Linear Formula: C16H22O10
Product Type: Chemical
| assay |
≥98% (HPLC) |
| biological source |
plant (Rubiaceae gardenia) |
| form |
powder |
| InChI |
1S/C16H22O10/c17-3-6-1-2-7-8(14(22)23)5-24-15(10(6)7)26-16-13(21)12(20)11(19)9(4-18)25-16/h1,5,7,9-13,15-21H,2-4H2,(H,22,23)/t7-,9-,10-,11-,12+,13-,15+,16+/m1/s1 |
| InChI key |
ZJDOESGVOWAULF-OGJQONSISA-N |
| Quality Level |
200  |
| SMILES string |
O[C@@H]1[C@@H](CO)O[C@@H](O[C@H]2[C@@](C(CO)=CC3)([H])[C@@]3([H])C(C(O)=O)=CO2)[C@H](O)[C@H]1O |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
Geniposidic acid acts as an anti-inflammatory and anti-cancer agent, and has known effectiveness for jaundice and hepatic disorders. It is a moderator of COX inhibition, is a HSF1 inducer, and plays a role in collagen synthesis. |
| General description: |
Geniposidic acid (GA) is a natural iridoid glucoside found in a variety of plants. |
| Packaging: |
5 mg in glass bottle |
| Symbol |
 GHS07 |
| Signal word |
Warning |
| Hazard statements |
H302 |
| Precautionary statements |
P301 + P312 + P330 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
