IM-12
SIGMA/SML0084 - ≥98% (HPLC)
Synonym: 3-
CAS Number: 1129669-05-1
Empirical Formula (Hill Notation): C22H20FN3O2
Molecular Weight: 377.41
MDL Number: MFCD20527313
Linear Formula: C22H20FN3O2
Product Type: Chemical
| assay | ≥98% (HPLC) |
| color | yellow-orange |
| form | powder |
| InChI | 1S/C22H20FN3O2/c1-13-18(1 |
| InChI key | ZKJAZFUFPPSFCO-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| SMILES string | CN1C(=O)C(NCCc2ccc(F)cc2) |
| solubility | DMSO: ≥9 mg/mL |
| storage condition | desiccated |
| storage temp. | 2-8°C |
| Biochem/physiol Actions: | GSK-3β inhibitor |
| Biochem/physiol Actions: | IM-12 is a cell-permeable indolylmaleimide that acts as a Glycogen synthase kinase 3β (GSK-3β) inhibitor, activating downstream components of canonical Wnt signaling. IM-12 significantly increased β-catenin levels. When used to treat human neural progenitor cells, IM-12 promoted neuronal differentiation resulting in an increase of neuronal cells. It has an IC50 of 53 nM in an in vitro binding assay, compared with 92 nM for SB-216763 in the same assay condition. |
| Packaging: | 5, 25 mg in glass bottle |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98% (HPLC) |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352200 |

