Synonym: 1-(1,3-benzothiazol-2-yl)-1-(2,4-dimethylphenyl)ethanol, a-(2,4-Dimethylphenyl)-a-methyl-2-benzothiazolemethanol.
Empirical Formula (Hill Notation): C17H17NOS
Molecular Weight: 283.39
MDL Number: MFCD20527324
Linear Formula: C17H17NOS
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to tan |
| form |
powder |
| InChI |
1S/C17H17NOS/c1-11-8-9-13(12(2)10-11)17(3,19)16-18-14-6-4-5-7-15(14)20-16/h4-10,19H,1-3H3 |
| InChI key |
IGSZVEPQZANNAB-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
Cc1ccc(c(C)c1)C(C)(O)c2nc3ccccc3s2 |
| solubility |
DMSO: ≥19 mg/mL |
| storage temp. |
2-8°C |
| Application: |
AC-265347 may be used in calcium-sensing receptor-mediated signaling. |
| Biochem/physiol Actions: |
AC-265347 is a calcimimetic that acts as agonist to calcium-sensing receptor. It reduces serum parathyroid hormone and plasma ionizable calcium. |
| Biochem/physiol Actions: |
AC-265347 is a human calcium-sensing receptor (CaSR) allosteric agonist. AC-265347 activates CaSR signaling in cellular proliferation and phosphatidyl inositol (PI) hydrolysis assays. |
| Packaging: |
5, 25 mg in glass bottle |
| Symbol |
 GHS07 |
| Signal word |
Warning |
| Hazard statements |
H319 |
| Precautionary statements |
P305 + P351 + P338 |
| Hazard Codes |
Xi |
| Risk Statements |
36 |
| Safety Statements |
26 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
