Metaxalone
SIGMA/SML0199 - ≥98% (HPLC)
Synonym: 5-
CAS Number: 1665-48-1
Empirical Formula (Hill Notation): C12H15NO3
Molecular Weight: 221.25
EC Number: 216-777-6
MDL Number: MFCD00867700
Linear Formula: C12H15NO3
Product Type: Chemical
| assay | ≥98% (HPLC) |
| color | white to tan |
| form | powder |
| InChI | 1S/C12H15NO3/c1-8-3-9(2)5 |
| InChI key | IMWZZHHPURKASS-UHFFFAOYSA |
| Quality Level | 100  |
| SMILES string | Cc1cc(C)cc(OCC2CNC(=O)O2) |
| solubility | DMSO: ≥2 mg/mL (warmed to 60 °C) |
| storage temp. | −20°C |
| Application: | Metaxalone may be used in cell signaling studies. |
| Biochem/physiol Actions: | Metaxalone is a muscle relaxant. The mechanism of action of metaxalone in humans is not fully understood. It was suggested that it acts through general central nervous system depression. |
| Biochem/physiol Actions: | Metaxalone is effective to relieve pain due to acute skeletal muscle pain caused due to musculoskeletal conditions and sprains. |
| Biochem/physiol Actions: | Muscle relaxant (skeletal) |
| Packaging: | 10, 50 mg in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98% (HPLC) |
| Storage Temp. | −20°C |
| UNSPSC | 12352200 |