Synonym: 3-((1R,3r,5S)-8-((5-Methylthiophen-2-yl)methyl)-8-azabicyclo[3.2.1]octan-3-yloxy)benzamide; 3-[[(3-endo)-8-[(5-methyl-2-thienyl)methyl]-8-azabicyclo[3.2.1]oct-3-yl]oxy]-benzamide
CAS Number: 1253405-06-9
Empirical Formula (Hill Notation): C20H24N2O2S
Molecular Weight: 356.48
MDL Number: MFCD22201005
Linear Formula: C20H24N2O2S
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C20H24N2O2S/c1-13-5-8-19(25-13)12-22-15-6-7-16(22)11-18(10-15)24-17-4-2-3-14(9-17)20(21)23/h2-5,8-9,15-16,18H,6-7,10-12H2,1H3,(H2,21,23)/t15-,16+,18+ |
| InChI key |
RLHOWHVHHMGIKE-VQFNDLOPSA-N |
| Quality Level |
100  |
| SMILES string |
Cc1ccc(CN2[C@H]3CC[C@@H]2C[C@@H](C3)Oc4cccc(c4)C(N)=O)s1 |
| solubility |
DMSO: ≥5 mg/mL at warmed to 60 °C |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
AZ-MTAB is a potent, short acting κ-opioid receptor (KOR) selective antagonist. |
| Biochem/physiol Actions: |
AZ-MTAB is a short acting κ-opioid receptor (KOR) selective antagonist |
| Packaging: |
5, 25 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
