Synonym: β-L-Thymidine; 1-(2-Deoxy-β-L-erythro-pentofuranosyl)-5-methyl-2,4(1H,3H)-Pyrimidinedione; 2′-Deoxy-L-thymidine; Epavudine; L-Thymidine; NV 02B; Sebivo
CAS Number: 3424-98-4
Empirical Formula (Hill Notation): C10H14N2O5
Molecular Weight: 242.23
MDL Number: MFCD02683612
Linear Formula: C10H14N2O5
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C10H14N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8+/m1/s1 |
| InChI key |
IQFYYKKMVGJFEH-CSMHCCOUSA-N |
| optical activity |
[α]/D -15 to -22°, c = 1 in H2O |
| Quality Level |
100  |
| SMILES string |
CC1=CN([C@@H]2C[C@@H](O)[C@H](CO)O2)C(=O)NC1=O |
| solubility |
H2O: 10 mg/mL (clear solution) |
| storage temp. |
2-8°C |
| Application: |
Telbivudine has been used to explore the mechanisms of telbivudine (LdT) induced creatine kinase (CK) elevation. |
| Biochem/physiol Actions: |
Telbivudine is a nucleoside analog that is widely used to treat hepatitis B virus (HBV) infection. |
| Biochem/physiol Actions: |
Telbivudine is a synthetic molecule containing β-L-configuration. Telbivudine improves the estimated glomerular filtration rate (eGFR) in response to chronic hepatitis B (CHB). It prevents perinatal transmission and enhances the hepatitis B e antigen (HBeAg) seroconversion. It is also known to cause side effects such as creatine kinase (CK) elevation and fatal rhabdomyolysis. |
| Biochem/physiol Actions: |
Telbivudineis a Hepatitis B antiviral agent. |
| Packaging: |
5, 25 mg in glass bottle |
| Symbol |
 GHS07 |
| Signal word |
Warning |
| Hazard statements |
H302 |
| Hazard Codes |
Xn |
| Risk Statements |
22 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
