Synonym: 3-[3,5-Dimethyl-4-[3-(3-methyl-5-isoxazolyl)propoxy]phenyl]-5-(trifluoromethyl)-1,2,4-oxadiazole; VP 63843; Win 63843
CAS Number: 153168-05-9
Empirical Formula (Hill Notation): C18H18F3N3O3
Molecular Weight: 381.35
MDL Number: MFCD00923611
Linear Formula: C18H18F3N3O3
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C18H18F3N3O3/c1-10-7-13(16-22-17(27-24-16)18(19,20)21)8-11(2)15(10)25-6-4-5-14-9-12(3)23-26-14/h7-9H,4-6H2,1-3H3 |
| InChI key |
KQOXLKOJHVFTRN-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
Cc1cc(CCCOc2c(C)cc(cc2C)-c3noc(n3)C(F)(F)F)on1 |
| solubility |
DMSO: ≥10 mg/mL (warmed) |
| storage temp. |
room temp |
| Application: |
Pleconaril has been used as a control or reference compound to assess the antiviral activities of the benzothiophene and other heteroaromatic derivatives against hRV-B14, hRV-A21 and hRV-A71. |
| Biochem/physiol Actions: |
Pleconaril is an effective drug against enteroviral infections. It can be used to treat chronic meningoencephalitis caused by echo virus 6.This can block viral replication by blocking the viral uncoating process and viral attachment to host cell receptors. |
| Biochem/physiol Actions: |
Pleconaril is an orally bioavailable, broad-spectrum antipicorna-viral agent that binds to hydrophobic pocket in VP1 major capsid protein. Also, pleconaril delays the onset of diabetes in experimental animals infected with Ljungan virus (LV). |
| General description: |
Pleconaril is a drug, that has antiviral activity. |
| Packaging: |
10, 50 mg in glass bottle |
| Symbol |
 GHS06 |
| Signal word |
Danger |
| Hazard statements |
H301 - H413 |
| Precautionary statements |
P273 - P301 + P310 + P330 |
| Hazard Codes |
T |
| Risk Statements |
25 |
| Safety Statements |
45 |
| RIDADR |
UN 2811 6.1 / PGIII |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
room temp |
| UNSPSC |
12352200 |
