Synonym: 6-Chloro-4-hydroxy-2-methyl-N-2-pyridinyl-2H-thieno[2,3-e]-1,2-thiazine-3-carboxamide 1,1-dioxide; Chlortenoxicam; Ro 13-9297; TS 110
CAS Number: 70374-39-9
Empirical Formula (Hill Notation): C13H10ClN3O4S2
Molecular Weight: 371.82
MDL Number: MFCD00866163
Linear Formula: C13H10ClN3O4S2
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
faintly yellow to dark yellow |
| form |
powder |
| InChI |
1S/C13H10ClN3O4S2/c1-17-10(13(19)16-9-4-2-3-5-15-9)11(18)12-7(23(17,20)21)6-8(14)22-12/h2-6,18H,1H3,(H,15,16,19) |
| InChI key |
WLHQHAUOOXYABV-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
CN1C(C(=O)Nc2ccccn2)=C(O)c3sc(Cl)cc3S1(=O)=O |
| solubility |
DMSO: >5 mg/mL (warmed) |
| storage temp. |
−20°C |
| Application: |
Lornoxicam has been used as a drug in melanin binding study with cassette dosing and rapid equilibrium dialysis inserts. |
| Biochem/physiol Actions: |
Lornoxicam is an oxicam-class NSAID with strong analgesic properties. |
| General description: |
Lornoxicam belongs to the oxicam class. It has anti-inflammatory and antipyretic properties. Lornoxicam prevents the synthesis of prostaglandin (PG) by inhibiting cyclo-oxygenase. It is used to relieve various types of symptoms associated with osteoarthritis, rheumatoid arthritis, ankylosing spondylitis, acute sciatica and low back pain. |
| Packaging: |
10, 50 mg in glass bottle |
| Symbol |
 GHS06 |
| Signal word |
Danger |
| Hazard statements |
H300 |
| Precautionary statements |
P264 - P301 + P310 |
| Hazard Codes |
T+ |
| Risk Statements |
28 |
| Safety Statements |
28-36/37-45 |
| RIDADR |
UN 2811 6.1 / PGII |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352200 |
