Synonym: 2-(3,4-Dihydroxyphenyl)-3-hydroxy-4H-benzopyran-4-one; 3, 3′, 4′-Trihydroxyflavone, DiOHF; 5,7-Dideoxyquercetin
CAS Number: 6068-78-6
Empirical Formula (Hill Notation): C15H10O5
Molecular Weight: 270.24
MDL Number: MFCD00189455
Linear Formula: C15H10O5
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
faintly yellow to dark yellow |
| form |
powder |
| InChI |
1S/C15H10O5/c16-10-6-5-8(7-11(10)17)15-14(19)13(18)9-3-1-2-4-12(9)20-15/h1-7,16-17,19H |
| InChI key |
KPGMHZQXQVDYNT-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
Oc1ccc(cc1O)C2=C(O)C(=O)c3ccccc3O2 |
| solubility |
DMSO: >15 mg/mL |
| storage condition |
protect from light |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
3’,4’-Dihydroxyflavonol is a synthetic cardioprotective flavone that attenuates myocardial ischemia/reperfusion injury, which associated with its antioxidant activity. |
| Packaging: |
5, 25 mg in glass bottle |
| Symbol |
 GHS06 |
| Signal word |
Danger |
| Hazard statements |
H301 |
| Precautionary statements |
P301 + P310 |
| Hazard Codes |
T |
| Risk Statements |
25 |
| Safety Statements |
45 |
| RIDADR |
UN 2811 6.1 / PGIII |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
