VK3-OCH3
SIGMA/SML0367 - ≥98% (HPLC)
Synonym: 2-
CAS Number: 255906-59-3
Empirical Formula (Hill Notation): C14H14O3S
Molecular Weight: 262.32
MDL Number: MFCD22575003
Linear Formula: C14H14O3S
Product Type: Chemical
| assay | ≥98% (HPLC) |
| color | light orange to dark orange |
| form | powder |
| InChI | 1S/C14H14O3S/c1-9-12(15)1 |
| InChI key | JTCRCMIBIBLUOK-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| SMILES string | COCCSC1=C(C)C(=O)c2ccccc2 |
| solubility | DMSO: 10 mg/mL (clear solution) |
| storage temp. | 2-8°C |
| Biochem/physiol Actions: | VK3-OCH3 is an analog of Vitamin K3 (Menadione) with potent antitumor activity. It has been shown to induce G2/M arrest and apoptosis in neuroblastoma cells with much less cytotoxicity towards normal cells. VK3-OCH3 is believed to act through up-regulation of heme oxygenase (HO)-1. |
| Biochem/physiol Actions: | VK3-OCH3 is an analog of Vitamin K3 with potent antitumor activity. |
| Packaging: | 5, 25 mg in glass bottle |
| Symbol | GHS09 |
| Signal word | Warning |
| Hazard statements | H400 |
| Precautionary statements | P273 |
| Hazard Codes | N |
| Risk Statements | 50 |
| Safety Statements | 61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98% (HPLC) |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352200 |


