BLT-4
SIGMA/SML0512 - ≥98% (HPLC)
Synonym: INF 271; MIT 9952-29; N-
CAS Number: 251917-79-0
Empirical Formula (Hill Notation): C18H16N2O2
Molecular Weight: 292.33
MDL Number: MFCD00406317
Linear Formula: C18H16N2O2
Product Type: Chemical
| assay | ≥98% (HPLC) |
| color | white to beige |
| form | powder |
| InChI | 1S/C18H16N2O2/c1-22-17-9- |
| InChI key | ISADADAHPHHLEM-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| SMILES string | COc1ccccc1NC(=O)Nc2ccc3cc |
| solubility | DMSO: 15 mg/mL (clear solution) |
| storage temp. | room temp |
| Biochem/physiol Actions: | BLT-4 is a blocker of lipid transport-4 (BLT-4). BLT-4 is a specific, reversible inhibitor of scavenger receptor, class B, type I (SR-BI) mediated lipid transfer. The molecule blocks the cellular uptake and transfer of cholesterol ester from HDL. |
| Biochem/physiol Actions: | BLT-4 is a SR-BI (Scavenger receptor, class B, type I) inhibitor. |
| Packaging: | 5, 25 mg in glass bottle |
| Symbol | GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273 - P501 |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98% (HPLC) |
| Storage Temp. | room temp |
| UNSPSC | 51111800 |


