NBD-556
SIGMA/SML0812 - ≥98% (HPLC)
Synonym: N1-
CAS Number: 333353-44-9
Empirical Formula (Hill Notation): C17H24ClN3O2
Molecular Weight: 337.84
Linear Formula: C17H24ClN3O2
Product Type: Chemical
| assay | ≥98% (HPLC) |
| color | white to beige |
| form | powder |
| InChI | 1S/C17H24ClN3O2/c1-16(2)9 |
| InChI key | ZKXLQCIOURANAD-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| SMILES string | Clc1ccc(cc1)NC(=O)C(=O)NC |
| solubility | DMSO: 15 mg/mL, clear |
| storage temp. | 2-8°C |
| Biochem/physiol Actions: | NBD-556 is small molecule mimetic of CD4 that recognizes the HIV-1 envelope protein gp120. |
| Biochem/physiol Actions: | NBD-556 is small molecule mimetic of CD4. NBD-556 recognizes the HIV-1 envelope protein gp120 and induces restructuring of gp120 analogous to CD4 binding. The CD4-induced conformational change in gp120 is necessary for interaction with CCR5. |
| Packaging: | 5, 25 mg in glass bottle |
| Symbol | GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301 + P310 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98% (HPLC) |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352200 |


