Sinomenine hydrochloride
SIGMA/SML1002 - ≥98% (HPLC)
Synonym: (9a,13a,14a)
CAS Number: 6080-33-7
Empirical Formula (Hill Notation): C19H23NO4 · HCl
Molecular Weight: 365.85
MDL Number: MFCD01714307
Linear Formula: C19H23NO4 · HCl
Product Type: Chemical
| assay | ≥98% (HPLC) |
| biological source | plant (Sinomenium acutum) |
| color | white to beige |
| drug control | regulated under CDSA - not available from Sigma-Aldrich Canada |
| form | powder |
| InChI | 1S/C19H23NO4.ClH/c1-20-7- |
| InChI key | YMEVIMJAUHZFMW-VUIDNZEBSA |
| optical activity | [α]/D -70 to -90°, c = 1 in H2O |
| Quality Level | 100 ![]() |
| SMILES string | OC1=C(OC)C=CC(C2)=C1[C@]3 |
| solubility | H2O: 20 mg/mL, clear |
| storage temp. | 2-8°C |
| Biochem/physiol Actions: | Sinomenine is a herbal medicine used to treat inflammatory diseases like rheumatoid arthritis. Sinomenine had anti-inflammatory effects in several animal models of inflammation, and inhibits mast cell degranulation and histamine release. Additionally, Sinomenine potentiates renewal of human embryonic stem cells. |
| Biochem/physiol Actions: | Sinomenine is a herbal medicine used to treat inflammatory diseases. |
| Symbol | ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302 + H312 + H332 - H315 - H319 - H335 - H351 |
| Precautionary statements | P201 - P280 - P301 + P312 + P330 - P302 + P352 + P312 - P304 + P340 + P312 - P308 + P313 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98% (HPLC) |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352200 |



