ICA-121431
SIGMA/SML1035 - ≥98% (HPLC)
Synonym: α-Phenyl-N-[4-[(2-thiazolylamino)sulfonyl]phenyl]-benzeneacetamide
CAS Number: 313254-51-2
Empirical Formula (Hill Notation): C23H19N3O3S2
Molecular Weight: 449.55
Linear Formula: C23H19N3O3S2
Product Type: Chemical
| assay | ≥98% (HPLC) |
| color | white to beige |
| form | powder |
| InChI | 1S/C23H19N3O3S2/c27-22(21 |
| InChI key | URSQNPPONHUJDL-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| SMILES string | [S](=O)(=O)(Nc4[s]ccn4)c1 |
| solubility | DMSO: 20 mg/mL, clear |
| storage temp. | room temp |
| Biochem/physiol Actions: | ICA-121431 is a potent, selective inhibitor of the human Nav1.3 and Nav1.1 voltage gated sodium channels (IC50 = 19 nM) with little or no activity against human Nav1.5 or Nav1.7 channels. |
| Biochem/physiol Actions: | ICA-121431 is a potent, selective inhibitor of the human Nav1.3 and Nav1.1 voltage gated sodium channels. |
| Biochem/physiol Actions: | ICA-121431 [2,2-diphenyl-N-(4-(N-thiazol-2-ylsulfamoyl)ph |
| Packaging: | 5, 25 mg in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H302 - H319 - H413 |
| Precautionary statements | P273 - P301 + P312 + P330 - P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98% (HPLC) |
| Storage Temp. | room temp |
| UNSPSC | 12352200 |


