BIX
SIGMA/SML1073 - ≥98% (HPLC)
Synonym: 2-
CAS Number: 101714-41-4
Empirical Formula (Hill Notation): C9H7NO3S
Molecular Weight: 209.22
MDL Number: MFCD22415334
Linear Formula: C9H7NO3S
Product Type: Chemical
| assay | ≥98% (HPLC) |
| color | white to beige |
| form | powder |
| InChI | 1S/C9H7NO3S/c10-5-14-4-9( |
| InChI key | SVFLBLCWKKQKDW-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| SMILES string | OC1=C(O)C=C(C(CSC#N)=O)C= |
| solubility | DMSO: 20 mg/mL, clear |
| storage temp. | 2-8°C |
| Application: | BIX has been used in cell viability assay. |
| Biochem/physiol Actions: | BIX (BiP protein inducer X) induces the expression of the endoplasmic reticulum chaperone protein GRP78 (glucose regulated protein 78, BiP) leading to an attenuation of the unfolded protein response. BIX protects neuronal cells and retinal cells from ER-stress induced cell death. |
| Biochem/physiol Actions: | BIX is an inducer of molecular chaperone GRP78 (BIP, Glucose regulated protein 78). |
| Other Notes: | air sensitive |
| Packaging: | 5, 25 mg in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P280 |
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98% (HPLC) |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352200 |


