Synonym: 2-[2,3-Dichloro-4-(2-methylene-1-oxobutyl)phenoxy]acetic acid; ECA; Etacrynic acid; [2,3-Dichloro-4-(2-ethylacryloyl)phenoxy]acetic acid; (2,3-Dichloro-4-[2-methylenebutyryl]phenoxy)acetic acid
CAS Number: 58-54-8
Empirical Formula (Hill Notation): C13H12Cl2O4
Molecular Weight: 303.14
EC Number: 200-384-1
MDL Number: MFCD00056693
Linear Formula: C13H12Cl2O4
Product Type: Chemical
| assay |
≥97% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C13H12Cl2O4/c1-3-7(2)13(18)8-4-5-9(12(15)11(8)14)19-6-10(16)17/h4-5H,2-3,6H2,1H3,(H,16,17) |
| InChI key |
AVOLMBLBETYQHX-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
ClC1=C(Cl)C(C(C(CC)=C)=O)=CC=C1OCC(O)=O |
| solubility |
DMSO: 20 mg/mL, clear |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
Ethacrynic acid increases the cytotoxicity of chlorambucil in rat and human tumor cell lines. |
| Biochem/physiol Actions: |
Ethacrynic acid is non sulfonamide loop diuretic that is used to treat high blood pressure and the swelling caused by diseases like congestive heart failure. Ethacrynic acid blocks sodium-potassium-chloride cotransport. Also, Ethacrynic acid potently inhibits glutathione S-transferase family members. Studies show that ethacrynic acid potently inhibits Tgase-2 (transglutaminase-2) dependent metastasis of cancer cells including lung and pancreatic cancers. |
| Packaging: |
10 mg in glass bottle |
| Symbol |
 GHS07 |
| Signal word |
Warning |
| Hazard statements |
H302 |
| Precautionary statements |
P301 + P312 + P330 |
| Hazard Codes |
Xn |
| Risk Statements |
20/21/22-36/37/38 |
| Safety Statements |
26-36 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥97% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
