Synonym: 4-[5,6-Dihydro-5,5-dimethyl-8-(quinolin-3-yl)naphthalen-2-carboxamido] benzoic acid; 4-[[[5,6-Dhydro-5,5-dimethyl-8-(3-quinolinyl)-2-naphthalenyl]carbonyl]amino]-benzoic acid; BMS 614; BMS-195614; BMS-614; BMS195614; BMS614
CAS Number: 182135-66-6
Empirical Formula (Hill Notation): C29H24N2O3
Molecular Weight: 448.51
MDL Number: MFCD00952209
Linear Formula: C29H24N2O3
Product Type: Chemical
| assay |
≥97% (HPLC) |
| color |
white to light brown |
| form |
powder |
| InChI |
1S/C29H24N2O3/c1-29(2)14-13-23(21-15-19-5-3-4-6-26(19)30-17-21)24-16-20(9-12-25(24)29)27(32)31-22-10-7-18(8-11-22)28(33)34/h3-13,15-17H,14H2,1-2H3,(H,31,32)(H,33,34) |
| InChI key |
WGLMBRZXZDAQHP-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
CC1(C)CC=C(C2=CN=C(C=CC=C3)C3=C2)C4=C1C=CC(C(NC5=CC=C(C(O)=O)C=C5)=O)=C4 |
| solubility |
DMSO: 20 mg/mL, clear |
| storage temp. |
−20°C |
| Biochem/physiol Actions: |
BMS-195614 (BMS614) is a potent neutral retinoic acid receptor RARα selective antagonist with an IC50 of 2.5 nM. |
| Biochem/physiol Actions: |
BMS-195614 (BMS614) is a potent neutral retinoic acid receptor RARα selective antagonist. |
| Packaging: |
5, 25 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥97% (HPLC) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352200 |