Synonym: (-)-Solasodine; (3β,22α,25R)-Spirosol-5-en-3-ol; NSC 178260; NSC 179187; Purapuridine; Solancarpidine; Solasod-5-en-3β-ol; Solasod-5-en-3β-ol (7CI,8CI); Solasodin
CAS Number: 126-17-0
Empirical Formula (Hill Notation): C27H43NO2
Molecular Weight: 413.64
EC Number: 204-774-2
Linear Formula: C27H43NO2
Product Type: Chemical
| assay |
≥95% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C27H43NO2/c1-16-7-12-27(28-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(29)8-10-25(18,3)21(20)9-11-26(22,24)4/h5,16-17,19-24,28-29H,6-15H2,1-4H3/t16-,17+,19+,20-,21+,22+,23+,24+,25+,26+,27-/m1/s1 |
| InChI key |
KWVISVAMQJWJSZ-VKROHFNGSA-N |
| optical activity |
[α]/D -88 to -98°, c = 0.2 in methanol |
| Quality Level |
100  |
| SMILES string |
C[C@@H]1[C@]2(NC[C@H](C)CC2)O[C@@]3([H])C[C@@]4([H])[C@]5([H])CC=C6C[C@@H](O)CC[C@]6(C)[C@@]5([H])CC[C@]4(C)[C@]31[H] |
| solubility |
DMSO: 0.5 mg/mL, clear (warmed) |
| storage temp. |
2-8°C |
| Application: |
Solasodine has been used in viability assays. |
| Biochem/physiol Actions: |
Solasodine is a neuroprotective antioxidant glycoalkaloid of Solanum species. Solasodine increases superoxide dismutase (SOD), catalase (CAT),and glutathione (GSH) levels, while reducing lipid peroxidation (LPO) and nitric oxide (NO) levels in the brains of ischemia/reperfusion (I/R)-injury model in rats. Also, Solasonine displayed multiple activities including, anti-cancer and leishmanicidal activities. |
| Biochem/physiol Actions: |
Solasodine is a neuroprotective antioxidant; anti-cancer; and leishmanicidal. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥95% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |