Synonym: 7-[[4-(1,1-Dimethylethyl)phenyl]methyl]-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione
CAS Number: 333415-38-6
Empirical Formula (Hill Notation): C18H22N4O2
Molecular Weight: 326.39
MDL Number: MFCD02648040
Linear Formula: C18H22N4O2
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C18H22N4O2/c1-18(2,3)13-8-6-12(7-9-13)10-22-11-19-15-14(22)16(23)21(5)17(24)20(15)4/h6-9,11H,10H2,1-5H3 |
| InChI key |
ZFZAIHKQJBMYLO-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
CN(C1=C2N(CC3=CC=C(C(C)(C)C)C=C3)C=N1)C(N(C)C2=O)=O |
| solubility |
DMSO: 10 mg/mL, clear |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
VU0071063 is a potent activator of Kir6.2/SUR1 KATP channels (EC50 = 10.3 μM). VU0071063 reversibly inhibits glucose-stimulated calcium influx in mouse β-islet cells. The compound VU0071063 has no affect on Kir6.2/SUR2A channels. |
| Biochem/physiol Actions: |
VU0071063 is a specific activator of SUR1-containing KATP channels. |
| Biochem/physiol Actions: |
VU0071063 is also known as [7-(4-(tert-butyl)benzyl)-1,3-dimethyl-1H-purine-2,6(3H,7H)-dione]. It serves as a major compound for examining β-cell physiology, KATP channel gating and a new chemical scaffold for evolving enhanced activators with medicinal chemistry. |
| Packaging: |
5, 25 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
