Synonym: 4-[[3,5-Bis(trifluoromethyl)phenyl]methyl]-6-(2-fluorophenyl)-4,5-dihydro-pyrido[3,2-f]-1,4-oxazepin-3(2H)-one
CAS Number: 877052-79-4
Empirical Formula (Hill Notation): C23H15F7N2O2
Molecular Weight: 484.37
MDL Number: MFCD27937760
Linear Formula: C23H15F7N2O2
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C23H15F7N2O2/c24-19-4-2-1-3-17(19)16-5-6-31-21-18(16)11-32(20(33)12-34-21)10-13-7-14(22(25,26)27)9-15(8-13)23(28,29)30/h1-9H,10-12H2 |
| InChI key |
ZIXNJVGTAXRKAP-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
O=C(CO1)N(CC2=CC(C(F)(F)F)=CC(C(F)(F)F)=C2)CC3=C1N=CC=C3C4=C(F)C=CC=C4 |
| solubility |
DMSO: 5 mg/mL, clear (warmed) |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
GPBAR-A is a very potent agonist of the bile acid receptor GPBA (also known as TGR5). |
| Biochem/physiol Actions: |
GPBAR-A is a very potent agonist of the bile acid receptor GPBA (also known as TGR5). In murine primary intestinal cultures, GPBAR-A induces an elevation in intracellular cAMP and calcium levels, and stimulates secretion of GLP-1. |
| Packaging: |
5, 25 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
51111800 |