Synonym: 4′-[1-[[2-(Phenylmethyl)-1-piperidinyl]carbonyl]-1H-1,2,3-triazol-4-yl]-[1,1′-biphenyl]-3-carboxylic acid
CAS Number: 1402612-64-9
Empirical Formula (Hill Notation): C28H26N4O3
Molecular Weight: 466.53
MDL Number: MFCD28118915
Linear Formula: C28H26N4O3
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C28H26N4O3/c33-27(34)24-10-6-9-23(18-24)21-12-14-22(15-13-21)26-19-32(30-29-26)28(35)31-16-5-4-11-25(31)17-20-7-2-1-3-8-20/h1-3,6-10,12-15,18-19,25H,4-5,11,16-17H2,(H,33,34) |
| InChI key |
SSSCOJOXPDDHOO-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
O=C(N1N=NC(C2=CC=C(C3=CC=CC(C(O)=O)=C3)C=C2)=C1)N4CCCCC4CC5=CC=CC=C5 |
| solubility |
DMSO: 20 mg/mL, clear |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
KT203 is a very potent, selective inhibitor of ABHD6 (IC50 = 0.82 nM). KT203 inhibits ABHD6 activity in the liver, but not the brain following ip injection in mice. |
| Packaging: |
5, 25 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
