Synonym: 4,9-Dihydro-4-(2-hydroxyethyl)-6-methoxy-9-phenyl-furo[3,4-b]quinolin-1(3H)-one; 4-(2-Hydroxyethyl)-6-methoxy-9-phenyl-4,9-dihydrofuro[3,4-b]quinolin-1(3H)-one
CAS Number: 1629908-92-4
Empirical Formula (Hill Notation): C20H19NO4
Molecular Weight: 337.37
MDL Number: MFCD28902215
Linear Formula: C20H19NO4
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C20H19NO4/c1-24-14-7-8-15-16(11-14)21(9-10-22)17-12-25-20(23)19(17)18(15)13-5-3-2-4-6-13/h2-8,11,18,22H,9-10,12H2,1H3 |
| InChI key |
SMEJQLRLHKWIFV-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
OCCN1C2=C(C(OC2)=O)C(C3=CC=CC=C3)C4=C1C=C(OC)C=C4 |
| solubility |
DMSO: 10 mg/mL, clear |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
NSC756093, a podophyllotoxin analog, is a potent and specific inhibitor of GBP1:PIM1 interaction that inhibits proliferation of paclitaxel resistant cancer cells. Apparently, NSC756093 stabilizes a conformation of GBP1 not suitable for binding to PIM1. |
| Biochem/physiol Actions: |
NSC756093, a podophyllotoxin analog, is a potent and specific inhibitor of GBP1:PIM1 interaction. |
| Packaging: |
5, 25 mg in glass bottle |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
GHS07,GHS09