Synonym: 1′-Butyl-4′-piperidinylmethyl ester; 8-Amino-7-chloro-2,3-dihydro-1,4-benzodioxan-5-carboxylic acid; N-1-Butyl-4-piperinylmethyl)-3,4-dihydro-2H-[1,3] oxazino[3,2-a]indole-10-carboxamide; Piboserod
CAS Number: 152811-62-6
Empirical Formula (Hill Notation): C22H31N3O2
Molecular Weight: 369.50
MDL Number: MFCD00923681
Linear Formula: C22H31N3O2
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C22H31N3O2/c1-2-3-11-24-13-9-17(10-14-24)16-23-21(26)20-18-7-4-5-8-19(18)25-12-6-15-27-22(20)25/h4-5,7-8,17H,2-3,6,9-16H2,1H3,(H,23,26) |
| InChI key |
KVCSJPATKXABRQ-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
O=C(NCC1CCN(CCCC)CC1)C2=C3N(CCCO3)C4=C2C=CC=C4 |
| solubility |
DMSO: 5 mg/mL, clear (warmed) |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
SB-207266 is a potent, selective, orally active and long-acting 5-HT4 antagonist in vivo. |
| Biochem/physiol Actions: |
SB-207266 is a Serotonin 5-HT4 receptor antagonist in vivo. |
| Packaging: |
5, 25 mg in glass bottle |
| Symbol |
 GHS06 |
| Signal word |
Danger |
| Hazard statements |
H301 |
| Precautionary statements |
P301 + P310 + P330 |
| RIDADR |
UN 2811 6.1 / PGIII |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
