Synonym: 2-[[3,4-Dihydro-4-oxo-3-[3-(1-pyrrolidinyl)propyl][1]benzothieno[3,2-d]pyrimidin-2-yl]thio]-acetic acid ethyl ester; A37; Ethyl 2-((4-oxo-3-(3-(pyrrolidin-1-yl)propyl)-3,4-dihydrobenzo[4,5]thieno[3,2-d]pyrimidin-2-yl)thio)acetate
CAS Number: 896795-60-1
Empirical Formula (Hill Notation): C21H25N3O3S2
Molecular Weight: 431.57
Linear Formula: C21H25N3O3S2
Product Type: Chemical
| assay |
≥97% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C21H25N3O3S2/c1-2-27-17(25)14-28-21-22-18-15-8-3-4-9-16(15)29-19(18)20(26)24(21)13-7-12-23-10-5-6-11-23/h3-4,8-9H,2,5-7,10-14H2,1H3 |
| InChI key |
SKDRHRAYBYQVNU-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
O=C1N(CCCN2CCCC2)C(SCC(OCC)=O)=NC3=C1SC4=CC=CC=C43 |
| solubility |
DMSO: 10 mg/mL, clear |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
CM037 is a potent and selective inhibitor of human aldehyde dehydrogenase 1A1 (ALDH1A1). CM037 binds to the aldehyde binding pocket of ALDH1A1. |
| Biochem/physiol Actions: |
CM037 is a potent and selective inhibitor of human aldehyde dehydrogenase 1A1. |
| Packaging: |
5, 25 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥97% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
