Synonym: 4,5,6,7-Tetrachloro-1,3-indandione; 4,5,6,7-Tetrachloro-1H-indene-1,3(2H)-dione; CID 2729042; UCH-L3 Inhibitor
CAS Number: 30675-13-9
Empirical Formula (Hill Notation): C9H2Cl4O2
Molecular Weight: 283.92
MDL Number: MFCD00239209
Linear Formula: C9H2Cl4O2
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to light brown |
| form |
powder |
| InChI |
1S/C9H2Cl4O2/c10-6-4-2(14)1-3(15)5(4)7(11)9(13)8(6)12/h1H2 |
| InChI key |
IDLAOWFFKWRNHB-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
O=C1CC(C2=C(Cl)C(Cl)=C(Cl)C(Cl)=C21)=O |
| solubility |
DMSO: 5 mg/mL, clear |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
TCID is a cell penetrant potent and specific inhibitor of UCH-L3 (Ubiquitin carboxyl-terminal hydrolase isozyme L3). TCID is used to distinguish between UCH-L1 and UCH-L3 activities in cells. |
| Biochem/physiol Actions: |
TCID is a cell penetrant potent and specific inhibitor of UCH-L3. |
| Packaging: |
5, 25 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
