Synonym: 1-(2,3-Dimethoxybenzoyl)-4-[(3-methylphenoxy)acetyl]-piperazine (9CI); 1-[4-(2,3-Dimethoxybenzoyl)-1-piperazinyl]-2-(3-methylphenoxy)-ethanonemethylphenoxy)acetyl]-piperazine (9CI)
CAS Number: 423748-02-1
Empirical Formula (Hill Notation): C22H26N2O5
Molecular Weight: 398.45
MDL Number: MFCD03134667
Linear Formula: C22H26N2O5
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C22H26N2O5/c1-16-6-4-7-17(14-16)29-15-20(25)23-10-12-24(13-11-23)22(26)18-8-5-9-19(27-2)21(18)28-3/h4-9,14H,10-13,15H2,1-3H3 |
| InChI key |
LUMCNRKHZRYQOV-UHFFFAOYSA-N |
| Quality Level |
100  |
| shipped in |
wet ice |
| SMILES string |
O=C(COC1=CC(C)=CC=C1)N2CCN(C(C3=CC=CC(OC)=C3OC)=O)CC2 |
| solubility |
DMSO: 20 mg/mL, clear |
| storage condition |
desiccated |
| storage temp. |
−20°C |
| Biochem/physiol Actions: |
MS37452 is a selective Chromobox homolog 7 (CBX7) modulator that disrupts CBX7ChD binding to H3K27me3. MS37452 inhibits CBX7 binding to INK4/ARF gene locus, and induces decline of p14/ARF and p16/INK4a in human PC3 cells. |
| Biochem/physiol Actions: |
MS37452 is a selective Chromobox homolog 7 (CBX7) modulator. |
| Packaging: |
5, 25 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352200 |
