Synonym: 1H-Indole-3-carboxaldehyde 2-(5,6,7,?8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4-yl)hydrazone
CAS Number: 294193-86-5
Empirical Formula (Hill Notation): C19H17N5S
Molecular Weight: 347.44
MDL Number: MFCD00380620
Linear Formula: C19H17N5S
Product Type: Chemical
| assay |
≥95% (HPLC) |
| color |
light yellow to dark yellow |
| form |
powder |
| InChI |
1S/C19H17N5S/c1-3-7-15-13(5-1)12(9-20-15)10-23-24-18-17-14-6-2-4-8-16(14)25-19(17)22-11-21-18/h1,3,5,7,9-11,20H,2,4,6,8H2,(H,21,22,24) |
| InChI key |
AKDKHZVFMAWBFX-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
C1(C(NN=CC2=CNC3=C2C=CC=C3)=NC=N4)=C4SC5=C1CCCC5 |
| solubility |
DMSO: 10 mg/mL, clear |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
B32B3 is a potent, selective and cell permeable VprBP inhibitor that suppresses xenograft tumor growth. B32B3 potently inhibits VprBP dependent formation of phosphorylated histone H2A on threonine 120 (H2AT120p). |
| Biochem/physiol Actions: |
B32B3 is a potent, selective and cell permeable VprBP inhibitor. |
| Packaging: |
5, 25 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥95% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352200 |
