Synonym: 2-(5H-Chromeno[2,3-b]pyridin-7-yl)propanoic acid; 2-(5H-[1]-Benzopyrano[2,3-b]pyridin-7-yl)propionic acid; a-Methyl-5H-[1]benzopyrano[2,3-b]pyridine-7-acetic acid
CAS Number: 52549-17-4
Empirical Formula (Hill Notation): C15H13NO3
Molecular Weight: 255.27
MDL Number: MFCD00866111
Linear Formula: C15H13NO3
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to beige |
| form |
powder |
| InChI |
1S/C15H13NO3/c1-9(15(17)18)10-4-5-13-12(7-10)8-11-3-2-6-16-14(11)19-13/h2-7,9H,8H2,1H3,(H,17,18) |
| InChI key |
TVQZAMVBTVNYLA-UHFFFAOYSA-N |
| Quality Level |
100  |
| SMILES string |
OC(C(C)C1=CC2=C(C=C1)OC3=NC=CC=C3C2)=O |
| solubility |
DMSO: 20 mg/mL, clear |
| storage condition |
desiccated |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
Pranoprofen is a non-steroidal anti-inflammatory drug (NSAID) used primarily in ophthalmology. Pranoprofen is a cyclooxygenase (COX) inhibitor. |
| Biochem/physiol Actions: |
Pranoprofen is a non-steroidal anti-inflammatory drug (NSAID). |
| Biochem/physiol Actions: |
Pranoprofen is used in eyes to treat chronic allergic conjunctivitis. It is also used as an anti-inflammatory and analgesic drug after strabismus surgery. |
| General description: |
Pranoprofen is an arylalkanoic acid and a non-steroidal anti-inflammatory drug. |
| Packaging: |
50, 250 mg in glass bottle |
| Symbol |
 GHS06 |
| Signal word |
Danger |
| Hazard statements |
H301 |
| Precautionary statements |
P301 + P310 + P330 |
| RIDADR |
UN 2811 6.1 / PGIII |
| WGK Germany |
WGK 1 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
41106500 |
