Synonym: (Z-Leu-Leu-NHCH2)2CO; 1,3-Di-(N-Carboxybenzoyl-L-leucyl-L-leucyl)amino Acetone; 2,2′-(2-Oxo-1,3-propanediyl)bis[N-[(phenylmethoxy)carbonyl]-L-leucyl-L-leucinamide
CAS Number: 313664-40-3
Empirical Formula (Hill Notation): C43H64N6O9
Molecular Weight: 809.00
MDL Number: MFCD04974180
Linear Formula: C43H64N6O9
Product Type: Chemical
| assay |
≥98% (HPLC) |
| color |
white to light yellow |
| form |
powder |
| InChI |
1S/C43H64N6O9/c1-27(2)19-34(46-40(53)36(21-29(5)6)48-42(55)57-25-31-15-11-9-12-16-31)38(51)44-23-33(50)24-45-39(52)35(20-28(3)4)47-41(54)37(22-30(7)8)49-43(56)58-26-32-17-13-10-14-18-32/h9-18,27-30,34-37H,19-26H2,1-8H3,(H,44,51)(H,45,52)(H,46,53)(H,47,54)(H,48,55)(H,49,56)/t34-,35-,36-,37-/m0/s1 |
| InChI key |
JTVCWQUNPMKMER-BQYLNSIHSA-N |
| Quality Level |
100  |
| shipped in |
wet ice |
| SMILES string |
O=C(N[C@@H](CC(C)C)C(N[C@@H](CC(C)C)C(NCC(CNC([C@H](CC(C)C)NC([C@H](CC(C)C)NC(OCC1=CC=CC=C1)=O)=O)=O)=O)=O)=O)OCC2=CC=CC=C2 |
| storage temp. |
−20°C |
| Biochem/physiol Actions: |
(Z-LL)2 Ketone is a selective inhibitor of signal peptide peptidase (SPP) that inhibits processing of the p-Prl signal peptide (IC50 = ~ 50 nM) without affecting the activities of signal peptidases and other proteases such as lysosomal cathepsins and proteasomes. |
| Biochem/physiol Actions: |
(Z-LL)2 Ketone is a selective inhibitor of signal peptide peptidase (SPP). |
| Biochem/physiol Actions: |
(Z-LL)2 Ketone serves as an inverse γ-secretase modulator (iGSM) by changing processivity of γ-secretase cleavage. |
| Packaging: |
1 mg in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98% (HPLC) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352200 |
